C22H27N3O2 — CID 69208256
N-[(1R)-1-hydroxy-1-phenylethyl]-1-piperazin-1-yl-2,3-dihydroindene-1-carboxamide (PubChem CID 69208256) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[(1R)-1-hydroxy-1-phenylethyl]-1-piperazin-1-yl-2,3-dihydroindene-1-carboxamide.
| Compound Name | N-[(1R)-1-hydroxy-1-phenylethyl]-1-piperazin-1-yl-2,3-dihydroindene-1-carboxamide |
|---|---|
| PubChem CID | 69208256 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-[(1R)-1-hydroxy-1-phenylethyl]-1-piperazin-1-yl-2,3-dihydroindene-1-carboxamide |
| SMILES | C[C@](O)(NC(=O)C1(N2CCNCC2)CCc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C22H27N3O2/c1-21(27,18-8-3-2-4-9-18)24-20(26)22(25-15-13-23-14-16-25)12-11-17-7-5-6-10-19(17)22/h2-10,23,27H,11-16H2,1H3,(H,24,26)/t21-,22?/m1/s1 |
| InChIKey | MLPAJQKFPIQHGM-ZMFCMNQTSA-N |
| XLogP | 1.71 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|