C20H19N5O3 — CID 69209035
[4-[4-amino-2-(4-methoxyphenyl)-4H-furo[2,3-d]pyrimidin-3-yl]phenyl]urea (PubChem CID 69209035) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is [4-[4-amino-2-(4-methoxyphenyl)-4H-furo[2,3-d]pyrimidin-3-yl]phenyl]urea.
| Compound Name | [4-[4-amino-2-(4-methoxyphenyl)-4H-furo[2,3-d]pyrimidin-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 69209035 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | [4-[4-amino-2-(4-methoxyphenyl)-4H-furo[2,3-d]pyrimidin-3-yl]phenyl]urea |
| SMILES | COc1ccc(C2=Nc3occc3C(N)N2c2ccc(NC(N)=O)cc2)cc1 |
| InChI | InChI=1S/C20H19N5O3/c1-27-15-8-2-12(3-9-15)18-24-19-16(10-11-28-19)17(21)25(18)14-6-4-13(5-7-14)23-20(22)26/h2-11,17H,21H2,1H3,(H3,22,23,26) |
| InChIKey | LVFAOHGMCIXFLA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |