C20H18N2O — CID 69214353
3,3-dimethyl-1-phenacylidene-2,4-dihydroisoquinoline-6-carbonitrile (PubChem CID 69214353) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is 3,3-dimethyl-1-phenacylidene-2,4-dihydroisoquinoline-6-carbonitrile.
| Compound Name | 3,3-dimethyl-1-phenacylidene-2,4-dihydroisoquinoline-6-carbonitrile |
|---|---|
| PubChem CID | 69214353 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 3,3-dimethyl-1-phenacylidene-2,4-dihydroisoquinoline-6-carbonitrile |
| SMILES | CC1(C)Cc2cc(C#N)ccc2C(=CC(=O)c2ccccc2)N1 |
| InChI | InChI=1S/C20H18N2O/c1-20(2)12-16-10-14(13-21)8-9-17(16)18(22-20)11-19(23)15-6-4-3-5-7-15/h3-11,22H,12H2,1-2H3 |
| InChIKey | BQVGHPMPEPNDOE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|