C20H25ClN4O2 — CID 69219571
methyl 2-[2-amino-4-[(4-methylpiperazin-1-yl)methyl]anilino]-4-chlorobenzoate (PubChem CID 69219571) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is methyl 2-[2-amino-4-[(4-methylpiperazin-1-yl)methyl]anilino]-4-chlorobenzoate.
| Compound Name | methyl 2-[2-amino-4-[(4-methylpiperazin-1-yl)methyl]anilino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 69219571 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | methyl 2-[2-amino-4-[(4-methylpiperazin-1-yl)methyl]anilino]-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)cc1Nc1ccc(CN2CCN(C)CC2)cc1N |
| InChI | InChI=1S/C20H25ClN4O2/c1-24-7-9-25(10-8-24)13-14-3-6-18(17(22)11-14)23-19-12-15(21)4-5-16(19)20(26)27-2/h3-6,11-12,23H,7-10,13,22H2,1-2H3 |
| InChIKey | UBGBIVFQJLGCMD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|