C17H24N4O2 — CID 69229150
[1-ethyl-7-(4-methylpiperazin-1-yl)benzimidazol-2-yl]methyl acetate (PubChem CID 69229150) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is [1-ethyl-7-(4-methylpiperazin-1-yl)benzimidazol-2-yl]methyl acetate.
| Compound Name | [1-ethyl-7-(4-methylpiperazin-1-yl)benzimidazol-2-yl]methyl acetate |
|---|---|
| PubChem CID | 69229150 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | [1-ethyl-7-(4-methylpiperazin-1-yl)benzimidazol-2-yl]methyl acetate |
| SMILES | CCn1c(COC(C)=O)nc2cccc(N3CCN(C)CC3)c21 |
| InChI | InChI=1S/C17H24N4O2/c1-4-21-16(12-23-13(2)22)18-14-6-5-7-15(17(14)21)20-10-8-19(3)9-11-20/h5-7H,4,8-12H2,1-3H3 |
| InChIKey | AUCCKTJCQNGVBV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |