C18H25FN4O2 — CID 19101699
ethyl 2-[1-ethyl-5-fluoro-6-(4-methylpiperazin-1-yl)benzimidazol-2-yl]acetate (PubChem CID 19101699) has the molecular formula C18H25FN4O2 and a molecular weight of 348.42 g/mol. Its IUPAC name is ethyl 2-[1-ethyl-5-fluoro-6-(4-methylpiperazin-1-yl)benzimidazol-2-yl]acetate.
| Compound Name | ethyl 2-[1-ethyl-5-fluoro-6-(4-methylpiperazin-1-yl)benzimidazol-2-yl]acetate |
|---|---|
| PubChem CID | 19101699 |
| Molecular Formula | C18H25FN4O2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | ethyl 2-[1-ethyl-5-fluoro-6-(4-methylpiperazin-1-yl)benzimidazol-2-yl]acetate |
| SMILES | CCOC(=O)Cc1nc2cc(F)c(N3CCN(C)CC3)cc2n1CC |
| InChI | InChI=1S/C18H25FN4O2/c1-4-23-16-11-15(22-8-6-21(3)7-9-22)13(19)10-14(16)20-17(23)12-18(24)25-5-2/h10-11H,4-9,12H2,1-3H3 |
| InChIKey | YKQOMCNDMMEBDI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |