C17H20FN5O3 — CID 15751514
5-ethyl-8-fluoro-2-hydroxy-7-(4-methylpiperazin-1-yl)pyrimido[1,6-a]benzimidazole-1,3-dione (PubChem CID 15751514) has the molecular formula C17H20FN5O3 and a molecular weight of 361.38 g/mol. Its IUPAC name is 5-ethyl-8-fluoro-2-hydroxy-7-(4-methylpiperazin-1-yl)pyrimido[1,6-a]benzimidazole-1,3-dione.
| Compound Name | 5-ethyl-8-fluoro-2-hydroxy-7-(4-methylpiperazin-1-yl)pyrimido[1,6-a]benzimidazole-1,3-dione |
|---|---|
| PubChem CID | 15751514 |
| Molecular Formula | C17H20FN5O3 |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 5-ethyl-8-fluoro-2-hydroxy-7-(4-methylpiperazin-1-yl)pyrimido[1,6-a]benzimidazole-1,3-dione |
| SMILES | CCn1c2cc(N3CCN(C)CC3)c(F)cc2n2c(=O)n(O)c(=O)cc12 |
| InChI | InChI=1S/C17H20FN5O3/c1-3-21-13-9-12(20-6-4-19(2)5-7-20)11(18)8-14(13)22-15(21)10-16(24)23(26)17(22)25/h8-10,26H,3-7H2,1-2H3 |
| InChIKey | ONSMROORCAFMFX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 75.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|