C18H12O6-2 — CID 6923552
5-[(1R)-1-carboxylatoethoxy]-2-phenyl-1-benzofuran-3-carboxylate (PubChem CID 6923552) has the molecular formula C18H12O6-2 and a molecular weight of 324.29 g/mol. Its IUPAC name is 5-[(1R)-1-carboxylatoethoxy]-2-phenyl-1-benzofuran-3-carboxylate.
| Compound Name | 5-[(1R)-1-carboxylatoethoxy]-2-phenyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6923552 |
| Molecular Formula | C18H12O6-2 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 5-[(1R)-1-carboxylatoethoxy]-2-phenyl-1-benzofuran-3-carboxylate |
| SMILES | C[C@@H](Oc1ccc2oc(-c3ccccc3)c(C(=O)[O-])c2c1)C(=O)[O-] |
| InChI | InChI=1S/C18H14O6/c1-10(17(19)20)23-12-7-8-14-13(9-12)15(18(21)22)16(24-14)11-5-3-2-4-6-11/h2-10H,1H3,(H,19,20)(H,21,22)/p-2/t10-/m1/s1 |
| InChIKey | RBZWDICAXJFHSY-SNVBAGLBSA-L |
| XLogP | 0.98 |
| TPSA | 102.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |