C15H12ClFN4OS — CID 69236234
N-[[1-(4-amino-2-fluorophenyl)imidazol-4-yl]methyl]-5-chlorothiophene-2-carboxamide (PubChem CID 69236234) has the molecular formula C15H12ClFN4OS and a molecular weight of 350.81 g/mol. Its IUPAC name is N-[[1-(4-amino-2-fluorophenyl)imidazol-4-yl]methyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[[1-(4-amino-2-fluorophenyl)imidazol-4-yl]methyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 69236234 |
| Molecular Formula | C15H12ClFN4OS |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | N-[[1-(4-amino-2-fluorophenyl)imidazol-4-yl]methyl]-5-chlorothiophene-2-carboxamide |
| SMILES | Nc1ccc(-n2cnc(CNC(=O)c3ccc(Cl)s3)c2)c(F)c1 |
| InChI | InChI=1S/C15H12ClFN4OS/c16-14-4-3-13(23-14)15(22)19-6-10-7-21(8-20-10)12-2-1-9(18)5-11(12)17/h1-5,7-8H,6,18H2,(H,19,22) |
| InChIKey | BUFBEDMCTIVBKJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|