C21H17ClN6OS — CID 87222115
5-chloro-N-[[1-[4-[2-(cyanoamino)-2H-pyridin-1-yl]phenyl]imidazol-4-yl]methyl]thiophene-2-carboxamide (PubChem CID 87222115) has the molecular formula C21H17ClN6OS and a molecular weight of 436.93 g/mol. Its IUPAC name is 5-chloro-N-[[1-[4-[2-(cyanoamino)-2H-pyridin-1-yl]phenyl]imidazol-4-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[[1-[4-[2-(cyanoamino)-2H-pyridin-1-yl]phenyl]imidazol-4-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 87222115 |
| Molecular Formula | C21H17ClN6OS |
| Molecular Weight | 436.93 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 5-chloro-N-[[1-[4-[2-(cyanoamino)-2H-pyridin-1-yl]phenyl]imidazol-4-yl]methyl]thiophene-2-carboxamide |
| SMILES | N#CNC1C=CC=CN1c1ccc(-n2cnc(CNC(=O)c3ccc(Cl)s3)c2)cc1 |
| InChI | InChI=1S/C21H17ClN6OS/c22-19-9-8-18(30-19)21(29)24-11-15-12-27(14-26-15)16-4-6-17(7-5-16)28-10-2-1-3-20(28)25-13-23/h1-10,12,14,20,25H,11H2,(H,24,29) |
| InChIKey | MBONHZMEGRKJOF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 85.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.93 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|