C28H40FN5O6S — CID 69236719
(dimethylsulfamoylamino)-[(3S)-8-[1-[(4-fluorophenyl)methyl]cyclobutyl]-2-hydroxy-1-oxo-1-(pyridin-3-ylmethylamino)octan-3-yl]carbamic acid (PubChem CID 69236719) has the molecular formula C28H40FN5O6S and a molecular weight of 593.72 g/mol. Its IUPAC name is (dimethylsulfamoylamino)-[(3S)-8-[1-[(4-fluorophenyl)methyl]cyclobutyl]-2-hydroxy-1-oxo-1-(pyridin-3-ylmethylamino)octan-3-yl]carbamic acid.
| Compound Name | (dimethylsulfamoylamino)-[(3S)-8-[1-[(4-fluorophenyl)methyl]cyclobutyl]-2-hydroxy-1-oxo-1-(pyridin-3-ylmethylamino)octan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 69236719 |
| Molecular Formula | C28H40FN5O6S |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | (dimethylsulfamoylamino)-[(3S)-8-[1-[(4-fluorophenyl)methyl]cyclobutyl]-2-hydroxy-1-oxo-1-(pyridin-3-ylmethylamino)octan-3-yl]carbamic acid |
| SMILES | CN(C)S(=O)(=O)NN(C(=O)O)[C@@H](CCCCCC1(Cc2ccc(F)cc2)CCC1)C(O)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C28H40FN5O6S/c1-33(2)41(39,40)32-34(27(37)38)24(25(35)26(36)31-20-22-8-6-17-30-19-22)9-4-3-5-14-28(15-7-16-28)18-21-10-12-23(29)13-11-21/h6,8,10-13,17,19,24-25,32,35H,3-5,7,9,14-16,18,20H2,1-2H3,(H,31,36)(H,37,38)/t24-,25?/m0/s1 |
| InChIKey | IUTKCTQEOPLDJR-SKCDSABHSA-N |
| XLogP | 3.22 |
| TPSA | 152.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|