C27H35FIN5O5S — CID 142267740
[1-[(4-fluorophenyl)methyl]cyclobutyl]methyl N-[(3S)-7-[[iodo(methyl)sulfinamoyl]amino]-1,2-dioxo-1-(pyridin-3-ylmethylamino)heptan-3-yl]carbamate (PubChem CID 142267740) has the molecular formula C27H35FIN5O5S and a molecular weight of 687.58 g/mol. Its IUPAC name is [1-[(4-fluorophenyl)methyl]cyclobutyl]methyl N-[(3S)-7-[[iodo(methyl)sulfinamoyl]amino]-1,2-dioxo-1-(pyridin-3-ylmethylamino)heptan-3-yl]carbamate.
| Compound Name | [1-[(4-fluorophenyl)methyl]cyclobutyl]methyl N-[(3S)-7-[[iodo(methyl)sulfinamoyl]amino]-1,2-dioxo-1-(pyridin-3-ylmethylamino)heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 142267740 |
| Molecular Formula | C27H35FIN5O5S |
| Molecular Weight | 687.58 g/mol |
| Exact Mass | 687.14 |
| IUPAC Name | [1-[(4-fluorophenyl)methyl]cyclobutyl]methyl N-[(3S)-7-[[iodo(methyl)sulfinamoyl]amino]-1,2-dioxo-1-(pyridin-3-ylmethylamino)heptan-3-yl]carbamate |
| SMILES | CN(I)S(=O)NCCCC[C@H](NC(=O)OCC1(Cc2ccc(F)cc2)CCC1)C(=O)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C27H35FIN5O5S/c1-34(29)40(38)32-15-3-2-7-23(24(35)25(36)31-18-21-6-4-14-30-17-21)33-26(37)39-19-27(12-5-13-27)16-20-8-10-22(28)11-9-20/h4,6,8-11,14,17,23,32H,2-3,5,7,12-13,15-16,18-19H2,1H3,(H,31,36)(H,33,37)/t23-,40?/m0/s1 |
| InChIKey | TVIWKYCSZWOQTI-RVSAPWAISA-N |
| XLogP | 3.53 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|