C32H43N5O6 — CID 58979656
[1-(pyridin-3-ylmethyl)cyclobutyl]methyl N-[(3S)-7-(morpholine-4-carbonylamino)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate (PubChem CID 58979656) has the molecular formula C32H43N5O6 and a molecular weight of 593.73 g/mol. Its IUPAC name is [1-(pyridin-3-ylmethyl)cyclobutyl]methyl N-[(3S)-7-(morpholine-4-carbonylamino)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate.
| Compound Name | [1-(pyridin-3-ylmethyl)cyclobutyl]methyl N-[(3S)-7-(morpholine-4-carbonylamino)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 58979656 |
| Molecular Formula | C32H43N5O6 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.32 |
| IUPAC Name | [1-(pyridin-3-ylmethyl)cyclobutyl]methyl N-[(3S)-7-(morpholine-4-carbonylamino)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
| SMILES | C[C@@H](NC(=O)C(=O)[C@H](CCCCNC(=O)N1CCOCC1)NC(=O)OCC1(Cc2cccnc2)CCC1)c1ccccc1 |
| InChI | InChI=1S/C32H43N5O6/c1-24(26-10-3-2-4-11-26)35-29(39)28(38)27(12-5-6-16-34-30(40)37-17-19-42-20-18-37)36-31(41)43-23-32(13-8-14-32)21-25-9-7-15-33-22-25/h2-4,7,9-11,15,22,24,27H,5-6,8,12-14,16-21,23H2,1H3,(H,34,40)(H,35,39)(H,36,41)/t24-,27+/m1/s1 |
| InChIKey | UUQMIIDUANMODR-SQHAQQRYSA-N |
| XLogP | 3.55 |
| TPSA | 138.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|