C19H22N4O2 — CID 91919482
7-oxo-N,2-bis(pyridin-3-ylmethyl)azepane-2-carboxamide (PubChem CID 91919482) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 7-oxo-N,2-bis(pyridin-3-ylmethyl)azepane-2-carboxamide.
| Compound Name | 7-oxo-N,2-bis(pyridin-3-ylmethyl)azepane-2-carboxamide |
|---|---|
| PubChem CID | 91919482 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 7-oxo-N,2-bis(pyridin-3-ylmethyl)azepane-2-carboxamide |
| SMILES | O=C1CCCCC(Cc2cccnc2)(C(=O)NCc2cccnc2)N1 |
| InChI | InChI=1S/C19H22N4O2/c24-17-7-1-2-8-19(23-17,11-15-5-3-9-20-12-15)18(25)22-14-16-6-4-10-21-13-16/h3-6,9-10,12-13H,1-2,7-8,11,14H2,(H,22,25)(H,23,24) |
| InChIKey | YJBSDYRPDLLRDV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |