C22H25F3N2O5S — CID 69240272
4-[ethyl-[ethyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]sulfamoyl]-2,3-dihydro-1H-indene-2-carboxylic acid (PubChem CID 69240272) has the molecular formula C22H25F3N2O5S and a molecular weight of 486.51 g/mol. Its IUPAC name is 4-[ethyl-[ethyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]sulfamoyl]-2,3-dihydro-1H-indene-2-carboxylic acid.
| Compound Name | 4-[ethyl-[ethyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]sulfamoyl]-2,3-dihydro-1H-indene-2-carboxylic acid |
|---|---|
| PubChem CID | 69240272 |
| Molecular Formula | C22H25F3N2O5S |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 4-[ethyl-[ethyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]sulfamoyl]-2,3-dihydro-1H-indene-2-carboxylic acid |
| SMILES | CCN(Cc1ccc(OC(F)(F)F)cc1)N(CC)S(=O)(=O)c1cccc2c1CC(C(=O)O)C2 |
| InChI | InChI=1S/C22H25F3N2O5S/c1-3-26(14-15-8-10-18(11-9-15)32-22(23,24)25)27(4-2)33(30,31)20-7-5-6-16-12-17(21(28)29)13-19(16)20/h5-11,17H,3-4,12-14H2,1-2H3,(H,28,29) |
| InChIKey | YJTMENRGJLEIHN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|