C25H31F3N2O5S — CID 69240560
4-[ethyl-[pentyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]sulfamoyl]-2,3-dihydro-1H-indene-2-carboxylic acid (PubChem CID 69240560) has the molecular formula C25H31F3N2O5S and a molecular weight of 528.59 g/mol. Its IUPAC name is 4-[ethyl-[pentyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]sulfamoyl]-2,3-dihydro-1H-indene-2-carboxylic acid.
| Compound Name | 4-[ethyl-[pentyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]sulfamoyl]-2,3-dihydro-1H-indene-2-carboxylic acid |
|---|---|
| PubChem CID | 69240560 |
| Molecular Formula | C25H31F3N2O5S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 4-[ethyl-[pentyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]sulfamoyl]-2,3-dihydro-1H-indene-2-carboxylic acid |
| SMILES | CCCCCN(Cc1ccc(OC(F)(F)F)cc1)N(CC)S(=O)(=O)c1cccc2c1CC(C(=O)O)C2 |
| InChI | InChI=1S/C25H31F3N2O5S/c1-3-5-6-14-29(17-18-10-12-21(13-11-18)35-25(26,27)28)30(4-2)36(33,34)23-9-7-8-19-15-20(24(31)32)16-22(19)23/h7-13,20H,3-6,14-17H2,1-2H3,(H,31,32) |
| InChIKey | YXUXVUWPLWQHTE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|