C21H30ClNO2S — CID 69241138
N-[2-[4-[(4-propan-2-ylphenyl)sulfonylmethyl]phenyl]ethyl]propan-1-amine;hydrochloride (PubChem CID 69241138) has the molecular formula C21H30ClNO2S and a molecular weight of 396.00 g/mol. Its IUPAC name is N-[2-[4-[(4-propan-2-ylphenyl)sulfonylmethyl]phenyl]ethyl]propan-1-amine;hydrochloride.
| Compound Name | N-[2-[4-[(4-propan-2-ylphenyl)sulfonylmethyl]phenyl]ethyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 69241138 |
| Molecular Formula | C21H30ClNO2S |
| Molecular Weight | 396.00 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-[2-[4-[(4-propan-2-ylphenyl)sulfonylmethyl]phenyl]ethyl]propan-1-amine;hydrochloride |
| SMILES | CCCNCCc1ccc(CS(=O)(=O)c2ccc(C(C)C)cc2)cc1.Cl |
| InChI | InChI=1S/C21H29NO2S.ClH/c1-4-14-22-15-13-18-5-7-19(8-6-18)16-25(23,24)21-11-9-20(10-12-21)17(2)3;/h5-12,17,22H,4,13-16H2,1-3H3;1H |
| InChIKey | IAQNCCCCRBAOGU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.00 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|