C19H29Cl2N3O2S — CID 69243399
4-propan-2-yl-N-[6-[2-(propylamino)ethyl]-3-pyridinyl]benzenesulfonamide;dihydrochloride (PubChem CID 69243399) has the molecular formula C19H29Cl2N3O2S and a molecular weight of 434.43 g/mol. Its IUPAC name is 4-propan-2-yl-N-[6-[2-(propylamino)ethyl]-3-pyridinyl]benzenesulfonamide;dihydrochloride.
| Compound Name | 4-propan-2-yl-N-[6-[2-(propylamino)ethyl]-3-pyridinyl]benzenesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 69243399 |
| Molecular Formula | C19H29Cl2N3O2S |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 4-propan-2-yl-N-[6-[2-(propylamino)ethyl]-3-pyridinyl]benzenesulfonamide;dihydrochloride |
| SMILES | CCCNCCc1ccc(NS(=O)(=O)c2ccc(C(C)C)cc2)cn1.Cl.Cl |
| InChI | InChI=1S/C19H27N3O2S.2ClH/c1-4-12-20-13-11-17-7-8-18(14-21-17)22-25(23,24)19-9-5-16(6-10-19)15(2)3;;/h5-10,14-15,20,22H,4,11-13H2,1-3H3;2*1H |
| InChIKey | WTKBOQICDSLXGR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|