C21H29ClN2O2S — CID 69242109
N-[4-[2-(cyclopropylmethylamino)ethyl]phenyl]-4-propan-2-ylbenzenesulfonamide;hydrochloride (PubChem CID 69242109) has the molecular formula C21H29ClN2O2S and a molecular weight of 409.00 g/mol. Its IUPAC name is N-[4-[2-(cyclopropylmethylamino)ethyl]phenyl]-4-propan-2-ylbenzenesulfonamide;hydrochloride.
| Compound Name | N-[4-[2-(cyclopropylmethylamino)ethyl]phenyl]-4-propan-2-ylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 69242109 |
| Molecular Formula | C21H29ClN2O2S |
| Molecular Weight | 409.00 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[4-[2-(cyclopropylmethylamino)ethyl]phenyl]-4-propan-2-ylbenzenesulfonamide;hydrochloride |
| SMILES | CC(C)c1ccc(S(=O)(=O)Nc2ccc(CCNCC3CC3)cc2)cc1.Cl |
| InChI | InChI=1S/C21H28N2O2S.ClH/c1-16(2)19-7-11-21(12-8-19)26(24,25)23-20-9-5-17(6-10-20)13-14-22-15-18-3-4-18;/h5-12,16,18,22-23H,3-4,13-15H2,1-2H3;1H |
| InChIKey | VZKWTLWXUTUOAH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.00 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|