C20H18F3N5O3 — CID 69244820
N-[6-[4-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-2H-pyrimidin-1-yl]acetamide (PubChem CID 69244820) has the molecular formula C20H18F3N5O3 and a molecular weight of 433.39 g/mol. Its IUPAC name is N-[6-[4-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-2H-pyrimidin-1-yl]acetamide.
| Compound Name | N-[6-[4-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-2H-pyrimidin-1-yl]acetamide |
|---|---|
| PubChem CID | 69244820 |
| Molecular Formula | C20H18F3N5O3 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-[6-[4-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-2H-pyrimidin-1-yl]acetamide |
| SMILES | CC(=O)NN1CN=CC=C1Oc1ccc(NC(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H18F3N5O3/c1-13(29)27-28-12-24-10-9-18(28)31-17-7-5-15(6-8-17)25-19(30)26-16-4-2-3-14(11-16)20(21,22)23/h2-11H,12H2,1H3,(H,27,29)(H2,25,26,30) |
| InChIKey | XVHLFRATLURACT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |