C25H28Cl2N2O4SSi — CID 69245633
3-[(1R)-1-(2-chlorophenyl)ethoxy]-5-[6-chloro-5-(2-trimethylsilylethoxy)-6,7-dihydrobenzimidazol-1-yl]thiophene-2-carboxylic acid (PubChem CID 69245633) has the molecular formula C25H28Cl2N2O4SSi and a molecular weight of 551.57 g/mol. Its IUPAC name is 3-[(1R)-1-(2-chlorophenyl)ethoxy]-5-[6-chloro-5-(2-trimethylsilylethoxy)-6,7-dihydrobenzimidazol-1-yl]thiophene-2-carboxylic acid.
| Compound Name | 3-[(1R)-1-(2-chlorophenyl)ethoxy]-5-[6-chloro-5-(2-trimethylsilylethoxy)-6,7-dihydrobenzimidazol-1-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 69245633 |
| Molecular Formula | C25H28Cl2N2O4SSi |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | 3-[(1R)-1-(2-chlorophenyl)ethoxy]-5-[6-chloro-5-(2-trimethylsilylethoxy)-6,7-dihydrobenzimidazol-1-yl]thiophene-2-carboxylic acid |
| SMILES | C[C@@H](Oc1cc(-n2cnc3c2CC(Cl)C(OCC[Si](C)(C)C)=C3)sc1C(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C25H28Cl2N2O4SSi/c1-15(16-7-5-6-8-17(16)26)33-22-13-23(34-24(22)25(30)31)29-14-28-19-12-21(18(27)11-20(19)29)32-9-10-35(2,3)4/h5-8,12-15,18H,9-11H2,1-4H3,(H,30,31)/t15-,18?/m1/s1 |
| InChIKey | YBWJLCZEFVCXSZ-NNJIEVJOSA-N |
| XLogP | 7.28 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|