C17H23N3O — CID 69246010
3-[(3-cyclopentyloxyphenyl)methyl]-2H-pyridine-2,3-diamine (PubChem CID 69246010) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-[(3-cyclopentyloxyphenyl)methyl]-2H-pyridine-2,3-diamine.
| Compound Name | 3-[(3-cyclopentyloxyphenyl)methyl]-2H-pyridine-2,3-diamine |
|---|---|
| PubChem CID | 69246010 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 3-[(3-cyclopentyloxyphenyl)methyl]-2H-pyridine-2,3-diamine |
| SMILES | NC1N=CC=CC1(N)Cc1cccc(OC2CCCC2)c1 |
| InChI | InChI=1S/C17H23N3O/c18-16-17(19,9-4-10-20-16)12-13-5-3-8-15(11-13)21-14-6-1-2-7-14/h3-5,8-11,14,16H,1-2,6-7,12,18-19H2 |
| InChIKey | CMODPFHGAIVMMJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |