C17H16F2N2O2 — CID 69246949
(1R,8R)-3-(2,4-difluorophenyl)-9,9-dimethyl-3,4-diazatricyclo[6.1.1.02,6]deca-2(6),4-diene-5-carboxylic acid (PubChem CID 69246949) has the molecular formula C17H16F2N2O2 and a molecular weight of 318.32 g/mol. Its IUPAC name is (1R,8R)-3-(2,4-difluorophenyl)-9,9-dimethyl-3,4-diazatricyclo[6.1.1.02,6]deca-2(6),4-diene-5-carboxylic acid.
| Compound Name | (1R,8R)-3-(2,4-difluorophenyl)-9,9-dimethyl-3,4-diazatricyclo[6.1.1.02,6]deca-2(6),4-diene-5-carboxylic acid |
|---|---|
| PubChem CID | 69246949 |
| Molecular Formula | C17H16F2N2O2 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (1R,8R)-3-(2,4-difluorophenyl)-9,9-dimethyl-3,4-diazatricyclo[6.1.1.02,6]deca-2(6),4-diene-5-carboxylic acid |
| SMILES | CC1(C)[C@H]2Cc3c(C(=O)O)nn(-c4ccc(F)cc4F)c3[C@@H]1C2 |
| InChI | InChI=1S/C17H16F2N2O2/c1-17(2)8-5-10-14(16(22)23)20-21(15(10)11(17)6-8)13-4-3-9(18)7-12(13)19/h3-4,7-8,11H,5-6H2,1-2H3,(H,22,23)/t8-,11-/m0/s1 |
| InChIKey | UPZCSELGTUCRHS-KWQFWETISA-N |
| XLogP | 3.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |