C21H16FN3O6 — CID 69247753
2-[3-(4-fluoro-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]ethyl pyridine-3-carboxylate (PubChem CID 69247753) has the molecular formula C21H16FN3O6 and a molecular weight of 425.37 g/mol. Its IUPAC name is 2-[3-(4-fluoro-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]ethyl pyridine-3-carboxylate.
| Compound Name | 2-[3-(4-fluoro-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]ethyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 69247753 |
| Molecular Formula | C21H16FN3O6 |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 2-[3-(4-fluoro-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]ethyl pyridine-3-carboxylate |
| SMILES | O=C(OCCN1C(=O)CCC(N2C(=O)c3cccc(F)c3C2=O)C1=O)c1cccnc1 |
| InChI | InChI=1S/C21H16FN3O6/c22-14-5-1-4-13-17(14)20(29)25(18(13)27)15-6-7-16(26)24(19(15)28)9-10-31-21(30)12-3-2-8-23-11-12/h1-5,8,11,15H,6-7,9-10H2 |
| InChIKey | XDUNAVITWLUANZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 113.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|