C26H21N3O9S — CID 54589417
benzenesulfonic acid;[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl pyridine-3-carboxylate (PubChem CID 54589417) has the molecular formula C26H21N3O9S and a molecular weight of 551.53 g/mol. Its IUPAC name is benzenesulfonic acid;[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl pyridine-3-carboxylate.
| Compound Name | benzenesulfonic acid;[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 54589417 |
| Molecular Formula | C26H21N3O9S |
| Molecular Weight | 551.53 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | benzenesulfonic acid;[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl pyridine-3-carboxylate |
| SMILES | O=C(OCN1C(=O)CCC(N2C(=O)c3ccccc3C2=O)C1=O)c1cccnc1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C20H15N3O6.C6H6O3S/c24-16-8-7-15(23-17(25)13-5-1-2-6-14(13)18(23)26)19(27)22(16)11-29-20(28)12-4-3-9-21-10-12;7-10(8,9)6-4-2-1-3-5-6/h1-6,9-10,15H,7-8,11H2;1-5H,(H,7,8,9) |
| InChIKey | BMTVDUWJEHRQBX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 168.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|