C24H17N3O6 — CID 68708423
[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl isoquinoline-4-carboxylate (PubChem CID 68708423) has the molecular formula C24H17N3O6 and a molecular weight of 443.42 g/mol. Its IUPAC name is [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl isoquinoline-4-carboxylate.
| Compound Name | [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl isoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 68708423 |
| Molecular Formula | C24H17N3O6 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl isoquinoline-4-carboxylate |
| SMILES | O=C(OCN1C(=O)CCC(N2C(=O)c3ccccc3C2=O)C1=O)c1cncc2ccccc12 |
| InChI | InChI=1S/C24H17N3O6/c28-20-10-9-19(27-21(29)16-7-3-4-8-17(16)22(27)30)23(31)26(20)13-33-24(32)18-12-25-11-14-5-1-2-6-15(14)18/h1-8,11-12,19H,9-10,13H2 |
| InChIKey | WAZCCQATHYULJA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 113.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|