C20H16ClN3O6 — CID 57399709
[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl pyridine-3-carboxylate;hydrochloride (PubChem CID 57399709) has the molecular formula C20H16ClN3O6 and a molecular weight of 429.82 g/mol. Its IUPAC name is [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl pyridine-3-carboxylate;hydrochloride.
| Compound Name | [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl pyridine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 57399709 |
| Molecular Formula | C20H16ClN3O6 |
| Molecular Weight | 429.82 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl pyridine-3-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCN1C(=O)CCC(N2C(=O)c3ccccc3C2=O)C1=O)c1cccnc1 |
| InChI | InChI=1S/C20H15N3O6.ClH/c24-16-8-7-15(23-17(25)13-5-1-2-6-14(13)18(23)26)19(27)22(16)11-29-20(28)12-4-3-9-21-10-12;/h1-6,9-10,15H,7-8,11H2;1H |
| InChIKey | INOABVHQKAQRQG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 113.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.82 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|