C15H9ClN2O4 — CID 9106946
(1,3-dioxoisoindol-2-yl)methyl 6-chloropyridine-3-carboxylate (PubChem CID 9106946) has the molecular formula C15H9ClN2O4 and a molecular weight of 316.70 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 6-chloropyridine-3-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 9106946 |
| Molecular Formula | C15H9ClN2O4 |
| Molecular Weight | 316.70 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 6-chloropyridine-3-carboxylate |
| SMILES | O=C(OCN1C(=O)c2ccccc2C1=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C15H9ClN2O4/c16-12-6-5-9(7-17-12)15(21)22-8-18-13(19)10-3-1-2-4-11(10)14(18)20/h1-7H,8H2 |
| InChIKey | PEROFUHHKMJSGA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.70 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|