C18H17N2O5+ — CID 853068
ethyl 1-[2-(1,3-dioxoisoindol-2-yl)oxyethyl]pyridin-1-ium-3-carboxylate (PubChem CID 853068) has the molecular formula C18H17N2O5+ and a molecular weight of 341.34 g/mol. Its IUPAC name is ethyl 1-[2-(1,3-dioxoisoindol-2-yl)oxyethyl]pyridin-1-ium-3-carboxylate.
| Compound Name | ethyl 1-[2-(1,3-dioxoisoindol-2-yl)oxyethyl]pyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 853068 |
| Molecular Formula | C18H17N2O5+ |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | ethyl 1-[2-(1,3-dioxoisoindol-2-yl)oxyethyl]pyridin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)c1ccc[n+](CCON2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C18H17N2O5/c1-2-24-18(23)13-6-5-9-19(12-13)10-11-25-20-16(21)14-7-3-4-8-15(14)17(20)22/h3-9,12H,2,10-11H2,1H3/q+1 |
| InChIKey | OZKDQCPMIBDDCX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|