C23H21N3O6 — CID 69248810
4-[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]butyl pyridine-3-carboxylate (PubChem CID 69248810) has the molecular formula C23H21N3O6 and a molecular weight of 435.44 g/mol. Its IUPAC name is 4-[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]butyl pyridine-3-carboxylate.
| Compound Name | 4-[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]butyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 69248810 |
| Molecular Formula | C23H21N3O6 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 4-[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]butyl pyridine-3-carboxylate |
| SMILES | O=C(OCCCCN1C(=O)CCC(N2C(=O)c3ccccc3C2=O)C1=O)c1cccnc1 |
| InChI | InChI=1S/C23H21N3O6/c27-19-10-9-18(26-20(28)16-7-1-2-8-17(16)21(26)29)22(30)25(19)12-3-4-13-32-23(31)15-6-5-11-24-14-15/h1-2,5-8,11,14,18H,3-4,9-10,12-13H2 |
| InChIKey | BNLLCSVJHDPQEK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 113.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|