C23H23N3O7 — CID 69248803
2-[1-(4-hydroxybutyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione;pyridine-3-carboxylic acid (PubChem CID 69248803) has the molecular formula C23H23N3O7 and a molecular weight of 453.45 g/mol. Its IUPAC name is 2-[1-(4-hydroxybutyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione;pyridine-3-carboxylic acid.
| Compound Name | 2-[1-(4-hydroxybutyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione;pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 69248803 |
| Molecular Formula | C23H23N3O7 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-[1-(4-hydroxybutyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione;pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1.O=C1CCC(N2C(=O)c3ccccc3C2=O)C(=O)N1CCCCO |
| InChI | InChI=1S/C17H18N2O5.C6H5NO2/c20-10-4-3-9-18-14(21)8-7-13(17(18)24)19-15(22)11-5-1-2-6-12(11)16(19)23;8-6(9)5-2-1-3-7-4-5/h1-2,5-6,13,20H,3-4,7-10H2;1-4H,(H,8,9) |
| InChIKey | WNUYGUBFWDPZEH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 145.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|