C21H14N2O4S — CID 18080353
(1,3-dioxoisoindol-2-yl)methyl 2-phenylsulfanylpyridine-3-carboxylate (PubChem CID 18080353) has the molecular formula C21H14N2O4S and a molecular weight of 390.42 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-phenylsulfanylpyridine-3-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-phenylsulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 18080353 |
| Molecular Formula | C21H14N2O4S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-phenylsulfanylpyridine-3-carboxylate |
| SMILES | O=C(OCN1C(=O)c2ccccc2C1=O)c1cccnc1Sc1ccccc1 |
| InChI | InChI=1S/C21H14N2O4S/c24-19-15-9-4-5-10-16(15)20(25)23(19)13-27-21(26)17-11-6-12-22-18(17)28-14-7-2-1-3-8-14/h1-12H,13H2 |
| InChIKey | RHDFCDDFVSTOTB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|