C20H18BN4O4 — CID 69248758
CID 69248758 (PubChem CID 69248758) has the molecular formula C20H18BN4O4 and a molecular weight of 389.20 g/mol.
| Compound Name | CID 69248758 |
|---|---|
| PubChem CID | 69248758 |
| Molecular Formula | C20H18BN4O4 |
| Molecular Weight | 389.20 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | — |
| SMILES | N#CCCNC(=O)c1cccc(O[B]Oc2cccc(C(=O)NCCC#N)c2)c1 |
| InChI | InChI=1S/C20H18BN4O4/c22-9-3-11-24-19(26)15-5-1-7-17(13-15)28-21-29-18-8-2-6-16(14-18)20(27)25-12-4-10-23/h1-2,5-8,13-14H,3-4,11-12H2,(H,24,26)(H,25,27) |
| InChIKey | JCXJNQQVSKKDRO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|