C26H25ClF3N3O5S — CID 69253964
methyl 3-(3-carbamimidoylphenyl)-2-[1-(6-chloro-1-benzothiophene-2-carbonyl)pyrrolidin-2-yl]propanoate;2,2,2-trifluoroacetic acid (PubChem CID 69253964) has the molecular formula C26H25ClF3N3O5S and a molecular weight of 584.02 g/mol. Its IUPAC name is methyl 3-(3-carbamimidoylphenyl)-2-[1-(6-chloro-1-benzothiophene-2-carbonyl)pyrrolidin-2-yl]propanoate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 3-(3-carbamimidoylphenyl)-2-[1-(6-chloro-1-benzothiophene-2-carbonyl)pyrrolidin-2-yl]propanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69253964 |
| Molecular Formula | C26H25ClF3N3O5S |
| Molecular Weight | 584.02 g/mol |
| Exact Mass | 583.12 |
| IUPAC Name | methyl 3-(3-carbamimidoylphenyl)-2-[1-(6-chloro-1-benzothiophene-2-carbonyl)pyrrolidin-2-yl]propanoate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc(CC(C(=O)OC)C2CCCN2C(=O)c2cc3ccc(Cl)cc3s2)c1 |
| InChI | InChI=1S/C24H24ClN3O3S.C2HF3O2/c1-31-24(30)18(11-14-4-2-5-16(10-14)22(26)27)19-6-3-9-28(19)23(29)21-12-15-7-8-17(25)13-20(15)32-21;3-2(4,5)1(6)7/h2,4-5,7-8,10,12-13,18-19H,3,6,9,11H2,1H3,(H3,26,27);(H,6,7) |
| InChIKey | MZILVSDVAQGCQB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.02 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|