C13H15F3N4 — CID 69254435
9-cyclopentyl-6-(3,3,3-trifluoropropyl)purine (PubChem CID 69254435) has the molecular formula C13H15F3N4 and a molecular weight of 284.29 g/mol. Its IUPAC name is 9-cyclopentyl-6-(3,3,3-trifluoropropyl)purine.
| Compound Name | 9-cyclopentyl-6-(3,3,3-trifluoropropyl)purine |
|---|---|
| PubChem CID | 69254435 |
| Molecular Formula | C13H15F3N4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 9-cyclopentyl-6-(3,3,3-trifluoropropyl)purine |
| SMILES | FC(F)(F)CCc1ncnc2c1ncn2C1CCCC1 |
| InChI | InChI=1S/C13H15F3N4/c14-13(15,16)6-5-10-11-12(18-7-17-10)20(8-19-11)9-3-1-2-4-9/h7-9H,1-6H2 |
| InChIKey | XMNQBPRKMOUOGU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |