C14H18F3N5 — CID 10267710
9-cycloheptyl-N-methyl-2-(trifluoromethyl)purin-6-amine (PubChem CID 10267710) has the molecular formula C14H18F3N5 and a molecular weight of 313.33 g/mol. Its IUPAC name is 9-cycloheptyl-N-methyl-2-(trifluoromethyl)purin-6-amine.
| Compound Name | 9-cycloheptyl-N-methyl-2-(trifluoromethyl)purin-6-amine |
|---|---|
| PubChem CID | 10267710 |
| Molecular Formula | C14H18F3N5 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 9-cycloheptyl-N-methyl-2-(trifluoromethyl)purin-6-amine |
| SMILES | CNc1nc(C(F)(F)F)nc2c1ncn2C1CCCCCC1 |
| InChI | InChI=1S/C14H18F3N5/c1-18-11-10-12(21-13(20-11)14(15,16)17)22(8-19-10)9-6-4-2-3-5-7-9/h8-9H,2-7H2,1H3,(H,18,20,21) |
| InChIKey | XSFTYXJAEDBBHT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |