C17H20N2S3+2 — CID 6926113
2-thiophen-2-yl-1,3-bis(thiophen-2-ylmethyl)imidazolidine-1,3-diium (PubChem CID 6926113) has the molecular formula C17H20N2S3+2 and a molecular weight of 348.56 g/mol. Its IUPAC name is 2-thiophen-2-yl-1,3-bis(thiophen-2-ylmethyl)imidazolidine-1,3-diium.
| Compound Name | 2-thiophen-2-yl-1,3-bis(thiophen-2-ylmethyl)imidazolidine-1,3-diium |
|---|---|
| PubChem CID | 6926113 |
| Molecular Formula | C17H20N2S3+2 |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-thiophen-2-yl-1,3-bis(thiophen-2-ylmethyl)imidazolidine-1,3-diium |
| SMILES | c1csc(C[NH+]2CC[NH+](Cc3cccs3)C2c2cccs2)c1 |
| InChI | InChI=1S/C17H18N2S3/c1-4-14(20-9-1)12-18-7-8-19(13-15-5-2-10-21-15)17(18)16-6-3-11-22-16/h1-6,9-11,17H,7-8,12-13H2/p+2 |
| InChIKey | UDVRIMIDSZLUTC-UHFFFAOYSA-P |
| XLogP | 2.05 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |