About 5-methyl-2,5,6,7-tetrahydro-1H-cyclopenta[b]pyrazine
5-methyl-2,5,6,7-tetrahydro-1H-cyclopenta[b]pyrazine (PubChem CID 69268090) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 5-methyl-2,5,6,7-tetrahydro-1H-cyclopenta[b]pyrazine.
Analyze 5-methyl-2,5,6,7-tetrahydro-1H-cyclopenta[b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,5,6,7-tetrahydro-1H-cyclopenta[b]pyrazine?
The IUPAC name of 5-methyl-2,5,6,7-tetrahydro-1H-cyclopenta[b]pyrazine (CID 69268090) is 5-methyl-2,5,6,7-tetrahydro-1H-cyclopenta[b]pyrazine.
What is the SMILES notation for 5-methyl-2,5,6,7-tetrahydro-1H-cyclopenta[b]pyrazine?
The canonical SMILES for 5-methyl-2,5,6,7-tetrahydro-1H-cyclopenta[b]pyrazine is CC1CCC2=C1N=CCN2.
What is the InChIKey of 5-methyl-2,5,6,7-tetrahydro-1H-cyclopenta[b]pyrazine?
The InChIKey is COSMFKAROKURLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-6-2-3-7-8(6)10-5-4-9-7/h5-6,9H,2-4H2,1H3.
What are the key properties of 5-methyl-2,5,6,7-tetrahydro-1H-cyclopenta[b]pyrazine?
5-methyl-2,5,6,7-tetrahydro-1H-cyclopenta[b]pyrazine has a molecular weight of 136.20 g/mol, XLogP of 1.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,5,6,7-tetrahydro-1H-cyclopenta[b]pyrazine is sourced from PubChem (CID 69268090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).