C11H18N2 — CID 142055314
(6R,7S)-2,3,6,7-tetramethyl-2,3,6,7-tetrahydro-1H-pyrrolo[3,2-b]pyridine (PubChem CID 142055314) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (6R,7S)-2,3,6,7-tetramethyl-2,3,6,7-tetrahydro-1H-pyrrolo[3,2-b]pyridine.
| Compound Name | (6R,7S)-2,3,6,7-tetramethyl-2,3,6,7-tetrahydro-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 142055314 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (6R,7S)-2,3,6,7-tetramethyl-2,3,6,7-tetrahydro-1H-pyrrolo[3,2-b]pyridine |
| SMILES | CC1NC2=C(N=C[C@H](C)[C@@H]2C)C1C |
| InChI | InChI=1S/C11H18N2/c1-6-5-12-10-8(3)9(4)13-11(10)7(6)2/h5-9,13H,1-4H3/t6-,7-,8?,9?/m0/s1 |
| InChIKey | YVVPTBFXVVFCAH-MSIFESELSA-N |
| XLogP | 2.18 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |