C23H27N5O2 — CID 69273702
3-(3,5-dicyano-2,6-dimethyl-1,4-dihydropyridin-4-yl)-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 69273702) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 3-(3,5-dicyano-2,6-dimethyl-1,4-dihydropyridin-4-yl)-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 3-(3,5-dicyano-2,6-dimethyl-1,4-dihydropyridin-4-yl)-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 69273702 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 3-(3,5-dicyano-2,6-dimethyl-1,4-dihydropyridin-4-yl)-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | CC1=C(C#N)C(c2cccc(C(=O)NCCCN3CCOCC3)c2)C(C#N)=C(C)N1 |
| InChI | InChI=1S/C23H27N5O2/c1-16-20(14-24)22(21(15-25)17(2)27-16)18-5-3-6-19(13-18)23(29)26-7-4-8-28-9-11-30-12-10-28/h3,5-6,13,22,27H,4,7-12H2,1-2H3,(H,26,29) |
| InChIKey | UTWCGCDYDYFLKA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|