About N-[1-[4-(1,3-benzoxazol-2-yloxy)phenyl]pentan-3-yl]-N-methylcyclopropanamine
N-[1-[4-(1,3-benzoxazol-2-yloxy)phenyl]pentan-3-yl]-N-methylcyclopropanamine (PubChem CID 69274191) has the molecular formula C22H26N2O2
and a molecular weight of 350.46 g/mol. Its IUPAC name is N-[1-[4-(1,3-benzoxazol-2-yloxy)phenyl]pentan-3-yl]-N-methylcyclopropanamine.
Molecular Properties
| Compound Name | N-[1-[4-(1,3-benzoxazol-2-yloxy)phenyl]pentan-3-yl]-N-methylcyclopropanamine |
| PubChem CID | 69274191 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N-[1-[4-(1,3-benzoxazol-2-yloxy)phenyl]pentan-3-yl]-N-methylcyclopropanamine |
| SMILES | CCC(CCc1ccc(Oc2nc3ccccc3o2)cc1)N(C)C1CC1 |
| InChI | InChI=1S/C22H26N2O2/c1-3-17(24(2)18-12-13-18)11-8-16-9-14-19(15-10-16)25-22-23-20-6-4-5-7-21(20)26-22/h4-7,9-10,14-15,17-18H,3,8,11-13H2,1-2H3 |
| InChIKey | HRZYMQKKOHZQAL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-[4-(1,3-benzoxazol-2-yloxy)phenyl]pentan-3-yl]-N-methylcyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[4-(1,3-benzoxazol-2-yloxy)phenyl]pentan-3-yl]-N-methylcyclopropanamine?
The IUPAC name of N-[1-[4-(1,3-benzoxazol-2-yloxy)phenyl]pentan-3-yl]-N-methylcyclopropanamine (CID 69274191) is N-[1-[4-(1,3-benzoxazol-2-yloxy)phenyl]pentan-3-yl]-N-methylcyclopropanamine.
What is the SMILES notation for N-[1-[4-(1,3-benzoxazol-2-yloxy)phenyl]pentan-3-yl]-N-methylcyclopropanamine?
The canonical SMILES for N-[1-[4-(1,3-benzoxazol-2-yloxy)phenyl]pentan-3-yl]-N-methylcyclopropanamine is CCC(CCc1ccc(Oc2nc3ccccc3o2)cc1)N(C)C1CC1.
What is the InChIKey of N-[1-[4-(1,3-benzoxazol-2-yloxy)phenyl]pentan-3-yl]-N-methylcyclopropanamine?
The InChIKey is HRZYMQKKOHZQAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2O2/c1-3-17(24(2)18-12-13-18)11-8-16-9-14-19(15-10-16)25-22-23-20-6-4-5-7-21(20)26-22/h4-7,9-10,14-15,17-18H,3,8,11-13H2,1-2H3.
What are the key properties of N-[1-[4-(1,3-benzoxazol-2-yloxy)phenyl]pentan-3-yl]-N-methylcyclopropanamine?
N-[1-[4-(1,3-benzoxazol-2-yloxy)phenyl]pentan-3-yl]-N-methylcyclopropanamine has a molecular weight of 350.46 g/mol, XLogP of 5.43, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[4-(1,3-benzoxazol-2-yloxy)phenyl]pentan-3-yl]-N-methylcyclopropanamine is sourced from PubChem (CID 69274191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).