C26H32N2O5 — CID 90861130
ethyl 6-[2-[4-(1,3-benzoxazol-2-yloxy)phenoxy]ethyl-cyclopropylamino]hexanoate (PubChem CID 90861130) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is ethyl 6-[2-[4-(1,3-benzoxazol-2-yloxy)phenoxy]ethyl-cyclopropylamino]hexanoate.
| Compound Name | ethyl 6-[2-[4-(1,3-benzoxazol-2-yloxy)phenoxy]ethyl-cyclopropylamino]hexanoate |
|---|---|
| PubChem CID | 90861130 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | ethyl 6-[2-[4-(1,3-benzoxazol-2-yloxy)phenoxy]ethyl-cyclopropylamino]hexanoate |
| SMILES | CCOC(=O)CCCCCN(CCOc1ccc(Oc2nc3ccccc3o2)cc1)C1CC1 |
| InChI | InChI=1S/C26H32N2O5/c1-2-30-25(29)10-4-3-7-17-28(20-11-12-20)18-19-31-21-13-15-22(16-14-21)32-26-27-23-8-5-6-9-24(23)33-26/h5-6,8-9,13-16,20H,2-4,7,10-12,17-19H2,1H3 |
| InChIKey | HCQFWYQXYPUEDV-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 74.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|