C28H30N4O4 — CID 91571170
1-[3-[2-[4-(1,3-benzoxazol-2-yloxy)phenoxy]ethyl-cyclopropylamino]propyl]-3-phenylurea (PubChem CID 91571170) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is 1-[3-[2-[4-(1,3-benzoxazol-2-yloxy)phenoxy]ethyl-cyclopropylamino]propyl]-3-phenylurea.
| Compound Name | 1-[3-[2-[4-(1,3-benzoxazol-2-yloxy)phenoxy]ethyl-cyclopropylamino]propyl]-3-phenylurea |
|---|---|
| PubChem CID | 91571170 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 1-[3-[2-[4-(1,3-benzoxazol-2-yloxy)phenoxy]ethyl-cyclopropylamino]propyl]-3-phenylurea |
| SMILES | O=C(NCCCN(CCOc1ccc(Oc2nc3ccccc3o2)cc1)C1CC1)Nc1ccccc1 |
| InChI | InChI=1S/C28H30N4O4/c33-27(30-21-7-2-1-3-8-21)29-17-6-18-32(22-11-12-22)19-20-34-23-13-15-24(16-14-23)35-28-31-25-9-4-5-10-26(25)36-28/h1-5,7-10,13-16,22H,6,11-12,17-20H2,(H2,29,30,33) |
| InChIKey | LXBIKMGXXIDUIZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|