C14H8N2S — CID 69275376
[1,3]benzothiazolo[4,5-h]quinoline (PubChem CID 69275376) has the molecular formula C14H8N2S and a molecular weight of 236.30 g/mol. Its IUPAC name is [1,3]benzothiazolo[4,5-h]quinoline.
| Compound Name | [1,3]benzothiazolo[4,5-h]quinoline |
|---|---|
| PubChem CID | 69275376 |
| Molecular Formula | C14H8N2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | [1,3]benzothiazolo[4,5-h]quinoline |
| SMILES | c1cnc2c(c1)ccc1c2ccc2scnc21 |
| InChI | InChI=1S/C14H8N2S/c1-2-9-3-4-11-10(13(9)15-7-1)5-6-12-14(11)16-8-17-12/h1-8H |
| InChIKey | SAFSECRCYPBHDL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|