C33H40Cl2FN5O5 — CID 69276799
[6,8-dichloro-3-[[2-[[2-(2-fluorophenyl)acetyl]amino]-3-methylpentanoyl]amino]-1,2,4,9-tetrahydrocarbazol-3-yl] N-(1-amino-3-methyl-1-oxopentan-2-yl)carbamate (PubChem CID 69276799) has the molecular formula C33H40Cl2FN5O5 and a molecular weight of 676.62 g/mol. Its IUPAC name is [6,8-dichloro-3-[[2-[[2-(2-fluorophenyl)acetyl]amino]-3-methylpentanoyl]amino]-1,2,4,9-tetrahydrocarbazol-3-yl] N-(1-amino-3-methyl-1-oxopentan-2-yl)carbamate.
| Compound Name | [6,8-dichloro-3-[[2-[[2-(2-fluorophenyl)acetyl]amino]-3-methylpentanoyl]amino]-1,2,4,9-tetrahydrocarbazol-3-yl] N-(1-amino-3-methyl-1-oxopentan-2-yl)carbamate |
|---|---|
| PubChem CID | 69276799 |
| Molecular Formula | C33H40Cl2FN5O5 |
| Molecular Weight | 676.62 g/mol |
| Exact Mass | 675.24 |
| IUPAC Name | [6,8-dichloro-3-[[2-[[2-(2-fluorophenyl)acetyl]amino]-3-methylpentanoyl]amino]-1,2,4,9-tetrahydrocarbazol-3-yl] N-(1-amino-3-methyl-1-oxopentan-2-yl)carbamate |
| SMILES | CCC(C)C(NC(=O)OC1(NC(=O)C(NC(=O)Cc2ccccc2F)C(C)CC)CCc2[nH]c3c(Cl)cc(Cl)cc3c2C1)C(N)=O |
| InChI | InChI=1S/C33H40Cl2FN5O5/c1-5-17(3)27(30(37)43)40-32(45)46-33(12-11-25-22(16-33)21-14-20(34)15-23(35)29(21)38-25)41-31(44)28(18(4)6-2)39-26(42)13-19-9-7-8-10-24(19)36/h7-10,14-15,17-18,27-28,38H,5-6,11-13,16H2,1-4H3,(H2,37,43)(H,39,42)(H,40,45)(H,41,44) |
| InChIKey | WZXVBNFUHDVNQM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 155.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|