C27H28ClF2N3O4S — CID 87549559
(3R)-8-chloro-6-fluoro-3-[[2-[[2-(2-fluorophenyl)-2-sulfanylacetyl]amino]-3-methylpentanoyl]amino]-1,2,4,9-tetrahydrocarbazole-3-carboxylic acid (PubChem CID 87549559) has the molecular formula C27H28ClF2N3O4S and a molecular weight of 564.05 g/mol. Its IUPAC name is (3R)-8-chloro-6-fluoro-3-[[2-[[2-(2-fluorophenyl)-2-sulfanylacetyl]amino]-3-methylpentanoyl]amino]-1,2,4,9-tetrahydrocarbazole-3-carboxylic acid.
| Compound Name | (3R)-8-chloro-6-fluoro-3-[[2-[[2-(2-fluorophenyl)-2-sulfanylacetyl]amino]-3-methylpentanoyl]amino]-1,2,4,9-tetrahydrocarbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 87549559 |
| Molecular Formula | C27H28ClF2N3O4S |
| Molecular Weight | 564.05 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | (3R)-8-chloro-6-fluoro-3-[[2-[[2-(2-fluorophenyl)-2-sulfanylacetyl]amino]-3-methylpentanoyl]amino]-1,2,4,9-tetrahydrocarbazole-3-carboxylic acid |
| SMILES | CCC(C)C(NC(=O)C(S)c1ccccc1F)C(=O)N[C@]1(C(=O)O)CCc2[nH]c3c(Cl)cc(F)cc3c2C1 |
| InChI | InChI=1S/C27H28ClF2N3O4S/c1-3-13(2)21(32-25(35)23(38)15-6-4-5-7-19(15)30)24(34)33-27(26(36)37)9-8-20-17(12-27)16-10-14(29)11-18(28)22(16)31-20/h4-7,10-11,13,21,23,31,38H,3,8-9,12H2,1-2H3,(H,32,35)(H,33,34)(H,36,37)/t13?,21?,23?,27-/m1/s1 |
| InChIKey | QEBHXVUPUZUKFL-XSQULZJASA-N |
| XLogP | 4.73 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.05 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|