C18H20NO5- — CID 6927801
2-[1-[2-oxo-2-[(3-oxo-1H-2-benzofuran-5-yl)amino]ethyl]cyclohexyl]acetate (PubChem CID 6927801) has the molecular formula C18H20NO5- and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-[1-[2-oxo-2-[(3-oxo-1H-2-benzofuran-5-yl)amino]ethyl]cyclohexyl]acetate.
| Compound Name | 2-[1-[2-oxo-2-[(3-oxo-1H-2-benzofuran-5-yl)amino]ethyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 6927801 |
| Molecular Formula | C18H20NO5- |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-[1-[2-oxo-2-[(3-oxo-1H-2-benzofuran-5-yl)amino]ethyl]cyclohexyl]acetate |
| SMILES | O=C([O-])CC1(CC(=O)Nc2ccc3c(c2)C(=O)OC3)CCCCC1 |
| InChI | InChI=1S/C18H21NO5/c20-15(9-18(10-16(21)22)6-2-1-3-7-18)19-13-5-4-12-11-24-17(23)14(12)8-13/h4-5,8H,1-3,6-7,9-11H2,(H,19,20)(H,21,22)/p-1 |
| InChIKey | PDULPNSDLRZDTK-UHFFFAOYSA-M |
| XLogP | 1.78 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |