C20H28NO3- — CID 8006656
2-[1-[2-(4-tert-butylanilino)-2-oxoethyl]cyclohexyl]acetate (PubChem CID 8006656) has the molecular formula C20H28NO3- and a molecular weight of 330.45 g/mol. Its IUPAC name is 2-[1-[2-(4-tert-butylanilino)-2-oxoethyl]cyclohexyl]acetate.
| Compound Name | 2-[1-[2-(4-tert-butylanilino)-2-oxoethyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 8006656 |
| Molecular Formula | C20H28NO3- |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 2-[1-[2-(4-tert-butylanilino)-2-oxoethyl]cyclohexyl]acetate |
| SMILES | CC(C)(C)c1ccc(NC(=O)CC2(CC(=O)[O-])CCCCC2)cc1 |
| InChI | InChI=1S/C20H29NO3/c1-19(2,3)15-7-9-16(10-8-15)21-17(22)13-20(14-18(23)24)11-5-4-6-12-20/h7-10H,4-6,11-14H2,1-3H3,(H,21,22)(H,23,24)/p-1 |
| InChIKey | NFLXHSAENLSXNQ-UHFFFAOYSA-M |
| XLogP | 3.40 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |