C18H18F6NO3- — CID 7221567
2-[1-[2-[3,5-bis(trifluoromethyl)anilino]-2-oxoethyl]cyclohexyl]acetate (PubChem CID 7221567) has the molecular formula C18H18F6NO3- and a molecular weight of 410.33 g/mol. Its IUPAC name is 2-[1-[2-[3,5-bis(trifluoromethyl)anilino]-2-oxoethyl]cyclohexyl]acetate.
| Compound Name | 2-[1-[2-[3,5-bis(trifluoromethyl)anilino]-2-oxoethyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 7221567 |
| Molecular Formula | C18H18F6NO3- |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-[1-[2-[3,5-bis(trifluoromethyl)anilino]-2-oxoethyl]cyclohexyl]acetate |
| SMILES | O=C([O-])CC1(CC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCCCC1 |
| InChI | InChI=1S/C18H19F6NO3/c19-17(20,21)11-6-12(18(22,23)24)8-13(7-11)25-14(26)9-16(10-15(27)28)4-2-1-3-5-16/h6-8H,1-5,9-10H2,(H,25,26)(H,27,28)/p-1 |
| InChIKey | UHKZHRFPDVYNNS-UHFFFAOYSA-M |
| XLogP | 4.14 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |