C15H16N2O — CID 6928002
(12R)-5-methyl-1,13-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5,9(16)-tetraen-8-one (PubChem CID 6928002) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is (12R)-5-methyl-1,13-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5,9(16)-tetraen-8-one.
| Compound Name | (12R)-5-methyl-1,13-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5,9(16)-tetraen-8-one |
|---|---|
| PubChem CID | 6928002 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (12R)-5-methyl-1,13-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5,9(16)-tetraen-8-one |
| SMILES | Cc1ccc2c(c1)c(=O)c1c3n2CCN[C@@H]3CC1 |
| InChI | InChI=1S/C15H16N2O/c1-9-2-5-13-11(8-9)15(18)10-3-4-12-14(10)17(13)7-6-16-12/h2,5,8,12,16H,3-4,6-7H2,1H3/t12-/m1/s1 |
| InChIKey | PNYWOKIRLFSQKT-GFCCVEGCSA-N |
| XLogP | 1.90 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |